5949-05-3 L(-)-Citronelal
| Nome do produto |
L(-)-Citronelal |
| Sinônimos |
;(S)-(-)-3,7-Dimetil-6-octenal; (S)-()-Citronelal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimetilocto-6-enal; (-)-Citronelal |
| Nome em inglês |
L(-)-Citronellal; (S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
| Fórmula molecular |
C10H18O |
| Peso Molecular |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
| CAS Registry Number |
5949-05-3 |
| EINECS |
227-707-9 |
| Estrutura Molecular |
|
| Densidade |
0.835g/cm3 |
| Ponto de ebulição |
208.4°C at 760 mmHg |
| índice de refração |
1.437 |
| O ponto de inflamação |
75.6°C |
| Pressão de vapor |
0.215mmHg at 25°C |
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|